C15H10CaO4 — CID 153423965
calcium 2,2-diphenylpropanedioate (PubChem CID 153423965) has the molecular formula C15H10CaO4 and a molecular weight of 294.32 g/mol. Its IUPAC name is calcium 2,2-diphenylpropanedioate.
| Compound Name | calcium 2,2-diphenylpropanedioate |
|---|---|
| PubChem CID | 153423965 |
| Molecular Formula | C15H10CaO4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | calcium 2,2-diphenylpropanedioate |
| SMILES | O=C([O-])C(C(=O)[O-])(c1ccccc1)c1ccccc1.[Ca+2] |
| InChI | InChI=1S/C15H12O4.Ca/c16-13(17)15(14(18)19,11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,(H,16,17)(H,18,19);/q;+2/p-2 |
| InChIKey | WCFBGYUDNCCTLE-UHFFFAOYSA-L |
| XLogP | -0.91 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|