C10H8F3O2- — CID 101271066
(2R)-3,3,3-trifluoro-2-methyl-2-phenylpropanoate (PubChem CID 101271066) has the molecular formula C10H8F3O2- and a molecular weight of 217.17 g/mol. Its IUPAC name is (2R)-3,3,3-trifluoro-2-methyl-2-phenylpropanoate.
| Compound Name | (2R)-3,3,3-trifluoro-2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 101271066 |
| Molecular Formula | C10H8F3O2- |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | (2R)-3,3,3-trifluoro-2-methyl-2-phenylpropanoate |
| SMILES | C[C@](C(=O)[O-])(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O2/c1-9(8(14)15,10(11,12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,14,15)/p-1/t9-/m1/s1 |
| InChIKey | LUPZGOUSFVXQNQ-SECBINFHSA-M |
| XLogP | 1.26 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |