C28H23F3O3S — CID 87756674
3,3,3-trifluoro-2-methoxy-2-phenylpropanoate;triphenylsulfanium (PubChem CID 87756674) has the molecular formula C28H23F3O3S and a molecular weight of 496.55 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate;triphenylsulfanium.
| Compound Name | 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate;triphenylsulfanium |
|---|---|
| PubChem CID | 87756674 |
| Molecular Formula | C28H23F3O3S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate;triphenylsulfanium |
| SMILES | COC(C(=O)[O-])(c1ccccc1)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C10H9F3O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-16-9(8(14)15,10(11,12)13)7-5-3-2-4-6-7/h1-15H;2-6H,1H3,(H,14,15)/q+1;/p-1 |
| InChIKey | AEKJUIVRGNLWSO-UHFFFAOYSA-M |
| XLogP | 5.62 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|