butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate

C14H17F3O3 — CID 13395967

IUPACbutan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate
SMILESCCC(C)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F
InChIInChI=1S/C14H17F3O3/c1-4-10(2)20-12(18)13(19-3,14(15,16)17)11-8-6-5-7-9-11/h5-10H,4H2,1-3H3/t10?,13-/m1/s1
InChIKeyRZPZNKONOGQNTC-JLOHTSLTSA-N
MW290.28 g/mol
LogP3.43
Rot. Bonds5

About butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate

butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 13395967) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.

Molecular Properties

Compound Namebutan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate
PubChem CID13395967
Molecular FormulaC14H17F3O3
Molecular Weight290.28 g/mol
Exact Mass290.11
IUPAC Namebutan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate
SMILESCCC(C)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F
InChIInChI=1S/C14H17F3O3/c1-4-10(2)20-12(18)13(19-3,14(15,16)17)11-8-6-5-7-9-11/h5-10H,4H2,1-3H3/t10?,13-/m1/s1
InChIKeyRZPZNKONOGQNTC-JLOHTSLTSA-N
XLogP3.43
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.28
LogP ≤ 53.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
The IUPAC name of butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (CID 13395967) is butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
What is the SMILES notation for butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
The canonical SMILES for butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate is CCC(C)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F.
What is the InChIKey of butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
The InChIKey is RZPZNKONOGQNTC-JLOHTSLTSA-N. The full InChI is InChI=1S/C14H17F3O3/c1-4-10(2)20-12(18)13(19-3,14(15,16)17)11-8-6-5-7-9-11/h5-10H,4H2,1-3H3/t10?,13-/m1/s1.
What are the key properties of butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate has a molecular weight of 290.28 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate is sourced from PubChem (CID 13395967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).