C18H22F6O3 — CID 102428011
[(2R)-1,1,1-trifluorooctan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 102428011) has the molecular formula C18H22F6O3 and a molecular weight of 400.36 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorooctan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2R)-1,1,1-trifluorooctan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 102428011 |
| Molecular Formula | C18H22F6O3 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [(2R)-1,1,1-trifluorooctan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCCC[C@@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H22F6O3/c1-3-4-5-9-12-14(17(19,20)21)27-15(25)16(26-2,18(22,23)24)13-10-7-6-8-11-13/h6-8,10-11,14H,3-5,9,12H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | DFKIGJSZJWLGAO-ZBFHGGJFSA-N |
| XLogP | 5.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|