C23H30F3NO3S — CID 10575830
[(1S)-1-(1,3-thiazol-2-yl)decyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10575830) has the molecular formula C23H30F3NO3S and a molecular weight of 457.56 g/mol. Its IUPAC name is [(1S)-1-(1,3-thiazol-2-yl)decyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S)-1-(1,3-thiazol-2-yl)decyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10575830 |
| Molecular Formula | C23H30F3NO3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | [(1S)-1-(1,3-thiazol-2-yl)decyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCCCCCC[C@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)c1nccs1 |
| InChI | InChI=1S/C23H30F3NO3S/c1-3-4-5-6-7-8-12-15-19(20-27-16-17-31-20)30-21(28)22(29-2,23(24,25)26)18-13-10-9-11-14-18/h9-11,13-14,16-17,19H,3-8,12,15H2,1-2H3/t19-,22-/m0/s1 |
| InChIKey | VHQUXQXYMRDFJI-UGKGYDQZSA-N |
| XLogP | 6.97 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|