C15H25NO2S — CID 10684418
[(1R)-1-(1,3-thiazol-2-yl)octyl] butanoate (PubChem CID 10684418) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is [(1R)-1-(1,3-thiazol-2-yl)octyl] butanoate.
| Compound Name | [(1R)-1-(1,3-thiazol-2-yl)octyl] butanoate |
|---|---|
| PubChem CID | 10684418 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | [(1R)-1-(1,3-thiazol-2-yl)octyl] butanoate |
| SMILES | CCCCCCC[C@@H](OC(=O)CCC)c1nccs1 |
| InChI | InChI=1S/C15H25NO2S/c1-3-5-6-7-8-10-13(15-16-11-12-19-15)18-14(17)9-4-2/h11-13H,3-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | IXWGVVBMCURPRU-CYBMUJFWSA-N |
| XLogP | 4.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|