C17H31NS — CID 130410551
2-tetradecan-7-yl-1,3-thiazole (PubChem CID 130410551) has the molecular formula C17H31NS and a molecular weight of 281.51 g/mol. Its IUPAC name is 2-tetradecan-7-yl-1,3-thiazole.
| Compound Name | 2-tetradecan-7-yl-1,3-thiazole |
|---|---|
| PubChem CID | 130410551 |
| Molecular Formula | C17H31NS |
| Molecular Weight | 281.51 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 2-tetradecan-7-yl-1,3-thiazole |
| SMILES | CCCCCCCC(CCCCCC)c1nccs1 |
| InChI | InChI=1S/C17H31NS/c1-3-5-7-9-11-13-16(12-10-8-6-4-2)17-18-14-15-19-17/h14-16H,3-13H2,1-2H3 |
| InChIKey | MFIAKUDEMQAQAB-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.51 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|