C10H16FNOS — CID 137426861
2-fluoro-1-(1,3-thiazol-2-yl)heptan-1-ol (PubChem CID 137426861) has the molecular formula C10H16FNOS and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-fluoro-1-(1,3-thiazol-2-yl)heptan-1-ol.
| Compound Name | 2-fluoro-1-(1,3-thiazol-2-yl)heptan-1-ol |
|---|---|
| PubChem CID | 137426861 |
| Molecular Formula | C10H16FNOS |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-fluoro-1-(1,3-thiazol-2-yl)heptan-1-ol |
| SMILES | CCCCCC(F)C(O)c1nccs1 |
| InChI | InChI=1S/C10H16FNOS/c1-2-3-4-5-8(11)9(13)10-12-6-7-14-10/h6-9,13H,2-5H2,1H3 |
| InChIKey | UCHDIERZTBBMJN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|