C18H25NO2S — CID 67224774
3-(4-hexoxyphenyl)-1-(1,3-thiazol-2-yl)propan-1-ol (PubChem CID 67224774) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is 3-(4-hexoxyphenyl)-1-(1,3-thiazol-2-yl)propan-1-ol.
| Compound Name | 3-(4-hexoxyphenyl)-1-(1,3-thiazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 67224774 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-(4-hexoxyphenyl)-1-(1,3-thiazol-2-yl)propan-1-ol |
| SMILES | CCCCCCOc1ccc(CCC(O)c2nccs2)cc1 |
| InChI | InChI=1S/C18H25NO2S/c1-2-3-4-5-13-21-16-9-6-15(7-10-16)8-11-17(20)18-19-12-14-22-18/h6-7,9-10,12,14,17,20H,2-5,8,11,13H2,1H3 |
| InChIKey | MOXJONCESPCGSO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|