C20H27NO2S — CID 174770722
3-(4-octylphenoxy)-2-(1,3-thiazol-2-yl)propanal (PubChem CID 174770722) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is 3-(4-octylphenoxy)-2-(1,3-thiazol-2-yl)propanal.
| Compound Name | 3-(4-octylphenoxy)-2-(1,3-thiazol-2-yl)propanal |
|---|---|
| PubChem CID | 174770722 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 3-(4-octylphenoxy)-2-(1,3-thiazol-2-yl)propanal |
| SMILES | CCCCCCCCc1ccc(OCC(C=O)c2nccs2)cc1 |
| InChI | InChI=1S/C20H27NO2S/c1-2-3-4-5-6-7-8-17-9-11-19(12-10-17)23-16-18(15-22)20-21-13-14-24-20/h9-15,18H,2-8,16H2,1H3 |
| InChIKey | DPUGLEBNDUJRNQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|