About 2-(4-hexylphenoxy)acetyl chloride
2-(4-hexylphenoxy)acetyl chloride (PubChem CID 86712364) has the molecular formula C14H19ClO2
and a molecular weight of 254.76 g/mol. Its IUPAC name is 2-(4-hexylphenoxy)acetyl chloride.
Molecular Properties
| Compound Name | 2-(4-hexylphenoxy)acetyl chloride |
| PubChem CID | 86712364 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(4-hexylphenoxy)acetyl chloride |
| SMILES | CCCCCCc1ccc(OCC(=O)Cl)cc1 |
| InChI | InChI=1S/C14H19ClO2/c1-2-3-4-5-6-12-7-9-13(10-8-12)17-11-14(15)16/h7-10H,2-6,11H2,1H3 |
| InChIKey | UFMZGSZEDGXASU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hexylphenoxy)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hexylphenoxy)acetyl chloride?
The IUPAC name of 2-(4-hexylphenoxy)acetyl chloride (CID 86712364) is 2-(4-hexylphenoxy)acetyl chloride.
What is the SMILES notation for 2-(4-hexylphenoxy)acetyl chloride?
The canonical SMILES for 2-(4-hexylphenoxy)acetyl chloride is CCCCCCc1ccc(OCC(=O)Cl)cc1.
What is the InChIKey of 2-(4-hexylphenoxy)acetyl chloride?
The InChIKey is UFMZGSZEDGXASU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClO2/c1-2-3-4-5-6-12-7-9-13(10-8-12)17-11-14(15)16/h7-10H,2-6,11H2,1H3.
What are the key properties of 2-(4-hexylphenoxy)acetyl chloride?
2-(4-hexylphenoxy)acetyl chloride has a molecular weight of 254.76 g/mol, XLogP of 3.95, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hexylphenoxy)acetyl chloride is sourced from PubChem (CID 86712364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).