C11H10N2OS — CID 82024295
3-pyridin-4-yl-2-(1,3-thiazol-2-yl)propanal (PubChem CID 82024295) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-pyridin-4-yl-2-(1,3-thiazol-2-yl)propanal.
| Compound Name | 3-pyridin-4-yl-2-(1,3-thiazol-2-yl)propanal |
|---|---|
| PubChem CID | 82024295 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 3-pyridin-4-yl-2-(1,3-thiazol-2-yl)propanal |
| SMILES | O=CC(Cc1ccncc1)c1nccs1 |
| InChI | InChI=1S/C11H10N2OS/c14-8-10(11-13-5-6-15-11)7-9-1-3-12-4-2-9/h1-6,8,10H,7H2 |
| InChIKey | AUTKHFNVHZWELD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|