C11H11NOS — CID 154527868
(1S)-2-phenyl-1-(1,3-thiazol-2-yl)ethanol (PubChem CID 154527868) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is (1S)-2-phenyl-1-(1,3-thiazol-2-yl)ethanol.
| Compound Name | (1S)-2-phenyl-1-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 154527868 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (1S)-2-phenyl-1-(1,3-thiazol-2-yl)ethanol |
| SMILES | O[C@@H](Cc1ccccc1)c1nccs1 |
| InChI | InChI=1S/C11H11NOS/c13-10(11-12-6-7-14-11)8-9-4-2-1-3-5-9/h1-7,10,13H,8H2/t10-/m0/s1 |
| InChIKey | HWMNNNUMCSZLOL-JTQLQIEISA-N |
| XLogP | 2.42 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |