C19H19NS — CID 176916353
2-(1,4-diphenylbutyl)-1,3-thiazole (PubChem CID 176916353) has the molecular formula C19H19NS and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-(1,4-diphenylbutyl)-1,3-thiazole.
| Compound Name | 2-(1,4-diphenylbutyl)-1,3-thiazole |
|---|---|
| PubChem CID | 176916353 |
| Molecular Formula | C19H19NS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(1,4-diphenylbutyl)-1,3-thiazole |
| SMILES | c1ccc(CCCC(c2ccccc2)c2nccs2)cc1 |
| InChI | InChI=1S/C19H19NS/c1-3-8-16(9-4-1)10-7-13-18(19-20-14-15-21-19)17-11-5-2-6-12-17/h1-6,8-9,11-12,14-15,18H,7,10,13H2 |
| InChIKey | LRQZILVBIXIHRG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |