C18H18N2OS — CID 10543000
(1S,2S)-2-(benzylamino)-2-phenyl-1-(1,3-thiazol-2-yl)ethanol (PubChem CID 10543000) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is (1S,2S)-2-(benzylamino)-2-phenyl-1-(1,3-thiazol-2-yl)ethanol.
| Compound Name | (1S,2S)-2-(benzylamino)-2-phenyl-1-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 10543000 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (1S,2S)-2-(benzylamino)-2-phenyl-1-(1,3-thiazol-2-yl)ethanol |
| SMILES | O[C@H](c1nccs1)[C@@H](NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2OS/c21-17(18-19-11-12-22-18)16(15-9-5-2-6-10-15)20-13-14-7-3-1-4-8-14/h1-12,16-17,20-21H,13H2/t16-,17-/m0/s1 |
| InChIKey | VNFCQXCRCJEZKW-IRXDYDNUSA-N |
| XLogP | 3.71 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |