C16H16F3NO — CID 10685271
(2R,3R)-3-(benzylamino)-1,1,1-trifluoro-3-phenylpropan-2-ol (PubChem CID 10685271) has the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. Its IUPAC name is (2R,3R)-3-(benzylamino)-1,1,1-trifluoro-3-phenylpropan-2-ol.
| Compound Name | (2R,3R)-3-(benzylamino)-1,1,1-trifluoro-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 10685271 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2R,3R)-3-(benzylamino)-1,1,1-trifluoro-3-phenylpropan-2-ol |
| SMILES | O[C@H]([C@H](NCc1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H16F3NO/c17-16(18,19)15(21)14(13-9-5-2-6-10-13)20-11-12-7-3-1-4-8-12/h1-10,14-15,20-21H,11H2/t14-,15-/m1/s1 |
| InChIKey | NUJFXGRGECQYLC-HUUCEWRRSA-N |
| XLogP | 3.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |