C16H23F3N2O — CID 44541164
(2S,3R)-3-(benzylamino)-4,4,4-trifluoro-1-piperidin-1-ylbutan-2-ol (PubChem CID 44541164) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is (2S,3R)-3-(benzylamino)-4,4,4-trifluoro-1-piperidin-1-ylbutan-2-ol.
| Compound Name | (2S,3R)-3-(benzylamino)-4,4,4-trifluoro-1-piperidin-1-ylbutan-2-ol |
|---|---|
| PubChem CID | 44541164 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (2S,3R)-3-(benzylamino)-4,4,4-trifluoro-1-piperidin-1-ylbutan-2-ol |
| SMILES | O[C@@H](CN1CCCCC1)[C@@H](NCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H23F3N2O/c17-16(18,19)15(20-11-13-7-3-1-4-8-13)14(22)12-21-9-5-2-6-10-21/h1,3-4,7-8,14-15,20,22H,2,5-6,9-12H2/t14-,15+/m0/s1 |
| InChIKey | KGSDQIVQCDQDPE-LSDHHAIUSA-N |
| XLogP | 2.55 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |