C20H26N2 — CID 11254892
(1S)-N-benzyl-1-phenyl-2-piperidin-1-ylethanamine (PubChem CID 11254892) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (1S)-N-benzyl-1-phenyl-2-piperidin-1-ylethanamine.
| Compound Name | (1S)-N-benzyl-1-phenyl-2-piperidin-1-ylethanamine |
|---|---|
| PubChem CID | 11254892 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (1S)-N-benzyl-1-phenyl-2-piperidin-1-ylethanamine |
| SMILES | c1ccc(CN[C@H](CN2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2/c1-4-10-18(11-5-1)16-21-20(19-12-6-2-7-13-19)17-22-14-8-3-9-15-22/h1-2,4-7,10-13,20-21H,3,8-9,14-17H2/t20-/m1/s1 |
| InChIKey | XWJKVBWFCZPRJJ-HXUWFJFHSA-N |
| XLogP | 4.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |