C14H24N2 — CID 143114287
(1R)-N-ethyl-1-phenyl-2-pyrrolidin-1-ylethanamine;molecular hydrogen (PubChem CID 143114287) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (1R)-N-ethyl-1-phenyl-2-pyrrolidin-1-ylethanamine;molecular hydrogen.
| Compound Name | (1R)-N-ethyl-1-phenyl-2-pyrrolidin-1-ylethanamine;molecular hydrogen |
|---|---|
| PubChem CID | 143114287 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (1R)-N-ethyl-1-phenyl-2-pyrrolidin-1-ylethanamine;molecular hydrogen |
| SMILES | CCN[C@@H](CN1CCCC1)c1ccccc1.[H][H] |
| InChI | InChI=1S/C14H22N2.H2/c1-2-15-14(12-16-10-6-7-11-16)13-8-4-3-5-9-13;/h3-5,8-9,14-15H,2,6-7,10-12H2,1H3;1H/t14-;/m0./s1 |
| InChIKey | NWOZYZBUVOMESR-UQKRIMTDSA-N |
| XLogP | 2.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |