C19H22Cl2N2O — CID 78823600
N-[(3,4-dichlorophenyl)methyl]-2-morpholin-4-yl-1-phenylethanamine (PubChem CID 78823600) has the molecular formula C19H22Cl2N2O and a molecular weight of 365.30 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-morpholin-4-yl-1-phenylethanamine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-morpholin-4-yl-1-phenylethanamine |
|---|---|
| PubChem CID | 78823600 |
| Molecular Formula | C19H22Cl2N2O |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-morpholin-4-yl-1-phenylethanamine |
| SMILES | Clc1ccc(CNC(CN2CCOCC2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C19H22Cl2N2O/c20-17-7-6-15(12-18(17)21)13-22-19(16-4-2-1-3-5-16)14-23-8-10-24-11-9-23/h1-7,12,19,22H,8-11,13-14H2 |
| InChIKey | WOMJXMIODHOECJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |