C17H15F3N2O3 — CID 132607818
(2R,3S)-3-(benzylamino)-4,4,4-trifluoro-2-nitro-1-phenylbutan-1-one (PubChem CID 132607818) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is (2R,3S)-3-(benzylamino)-4,4,4-trifluoro-2-nitro-1-phenylbutan-1-one.
| Compound Name | (2R,3S)-3-(benzylamino)-4,4,4-trifluoro-2-nitro-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 132607818 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (2R,3S)-3-(benzylamino)-4,4,4-trifluoro-2-nitro-1-phenylbutan-1-one |
| SMILES | O=C(c1ccccc1)[C@@H]([C@H](NCc1ccccc1)C(F)(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C17H15F3N2O3/c18-17(19,20)16(21-11-12-7-3-1-4-8-12)14(22(24)25)15(23)13-9-5-2-6-10-13/h1-10,14,16,21H,11H2/t14-,16-/m0/s1 |
| InChIKey | FNJBWRINBQCTDR-HOCLYGCPSA-N |
| XLogP | 3.24 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|