C15H19F3N2O3 — CID 132607821
(2R,3R)-2-(benzylamino)-1,1,1-trifluoro-6-methyl-3-nitroheptan-4-one (PubChem CID 132607821) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is (2R,3R)-2-(benzylamino)-1,1,1-trifluoro-6-methyl-3-nitroheptan-4-one.
| Compound Name | (2R,3R)-2-(benzylamino)-1,1,1-trifluoro-6-methyl-3-nitroheptan-4-one |
|---|---|
| PubChem CID | 132607821 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (2R,3R)-2-(benzylamino)-1,1,1-trifluoro-6-methyl-3-nitroheptan-4-one |
| SMILES | CC(C)CC(=O)[C@@H]([C@@H](NCc1ccccc1)C(F)(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C15H19F3N2O3/c1-10(2)8-12(21)13(20(22)23)14(15(16,17)18)19-9-11-6-4-3-5-7-11/h3-7,10,13-14,19H,8-9H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | IRTTVPCHGOZDNM-UONOGXRCSA-N |
| XLogP | 2.97 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|