C13H15ClF3NO2 — CID 11109662
ethyl (2R,3R)-3-(benzylamino)-2-chloro-4,4,4-trifluorobutanoate (PubChem CID 11109662) has the molecular formula C13H15ClF3NO2 and a molecular weight of 309.72 g/mol. Its IUPAC name is ethyl (2R,3R)-3-(benzylamino)-2-chloro-4,4,4-trifluorobutanoate.
| Compound Name | ethyl (2R,3R)-3-(benzylamino)-2-chloro-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 11109662 |
| Molecular Formula | C13H15ClF3NO2 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | ethyl (2R,3R)-3-(benzylamino)-2-chloro-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)[C@H](Cl)[C@H](NCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H15ClF3NO2/c1-2-20-12(19)10(14)11(13(15,16)17)18-8-9-6-4-3-5-7-9/h3-7,10-11,18H,2,8H2,1H3/t10-,11+/m1/s1 |
| InChIKey | MXQFWGSVWMBJNJ-MNOVXSKESA-N |
| XLogP | 2.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|