C18H22F3NO5 — CID 177460264
diethyl 2-[2-(benzylcarbamoyl)-3,3,3-trifluoropropyl]propanedioate (PubChem CID 177460264) has the molecular formula C18H22F3NO5 and a molecular weight of 389.37 g/mol. Its IUPAC name is diethyl 2-[2-(benzylcarbamoyl)-3,3,3-trifluoropropyl]propanedioate.
| Compound Name | diethyl 2-[2-(benzylcarbamoyl)-3,3,3-trifluoropropyl]propanedioate |
|---|---|
| PubChem CID | 177460264 |
| Molecular Formula | C18H22F3NO5 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | diethyl 2-[2-(benzylcarbamoyl)-3,3,3-trifluoropropyl]propanedioate |
| SMILES | CCOC(=O)C(CC(C(=O)NCc1ccccc1)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C18H22F3NO5/c1-3-26-16(24)13(17(25)27-4-2)10-14(18(19,20)21)15(23)22-11-12-8-6-5-7-9-12/h5-9,13-14H,3-4,10-11H2,1-2H3,(H,22,23) |
| InChIKey | WSOOWDZLKIQFBL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|