C19H19F3N2O3 — CID 174760145
[3-amino-1-(benzylamino)-1-oxo-4-phenylbutan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 174760145) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is [3-amino-1-(benzylamino)-1-oxo-4-phenylbutan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-amino-1-(benzylamino)-1-oxo-4-phenylbutan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174760145 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [3-amino-1-(benzylamino)-1-oxo-4-phenylbutan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | NC(Cc1ccccc1)C(OC(=O)C(F)(F)F)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H19F3N2O3/c20-19(21,22)18(26)27-16(15(23)11-13-7-3-1-4-8-13)17(25)24-12-14-9-5-2-6-10-14/h1-10,15-16H,11-12,23H2,(H,24,25) |
| InChIKey | WZZSUCDMXIYJTM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |