C25H29N3O2 — CID 10363807
(2R,3R,4S)-4-amino-N-benzyl-2-(benzylamino)-3-hydroxy-5-phenylpentanamide (PubChem CID 10363807) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is (2R,3R,4S)-4-amino-N-benzyl-2-(benzylamino)-3-hydroxy-5-phenylpentanamide.
| Compound Name | (2R,3R,4S)-4-amino-N-benzyl-2-(benzylamino)-3-hydroxy-5-phenylpentanamide |
|---|---|
| PubChem CID | 10363807 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (2R,3R,4S)-4-amino-N-benzyl-2-(benzylamino)-3-hydroxy-5-phenylpentanamide |
| SMILES | N[C@@H](Cc1ccccc1)[C@@H](O)[C@@H](NCc1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O2/c26-22(16-19-10-4-1-5-11-19)24(29)23(27-17-20-12-6-2-7-13-20)25(30)28-18-21-14-8-3-9-15-21/h1-15,22-24,27,29H,16-18,26H2,(H,28,30)/t22-,23+,24+/m0/s1 |
| InChIKey | UJAYHNWQMDIEOW-RBZQAINGSA-N |
| XLogP | 2.39 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |