C16H15Br3N2O — CID 2830571
N-[1-(benzylamino)-2,2,2-tribromoethyl]benzamide (PubChem CID 2830571) has the molecular formula C16H15Br3N2O and a molecular weight of 491.02 g/mol. Its IUPAC name is N-[1-(benzylamino)-2,2,2-tribromoethyl]benzamide.
| Compound Name | N-[1-(benzylamino)-2,2,2-tribromoethyl]benzamide |
|---|---|
| PubChem CID | 2830571 |
| Molecular Formula | C16H15Br3N2O |
| Molecular Weight | 491.02 g/mol |
| Exact Mass | 487.87 |
| IUPAC Name | N-[1-(benzylamino)-2,2,2-tribromoethyl]benzamide |
| SMILES | O=C(NC(NCc1ccccc1)C(Br)(Br)Br)c1ccccc1 |
| InChI | InChI=1S/C16H15Br3N2O/c17-16(18,19)15(20-11-12-7-3-1-4-8-12)21-14(22)13-9-5-2-6-10-13/h1-10,15,20H,11H2,(H,21,22) |
| InChIKey | JDFPCWDYZRTUTD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.02 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|