C16H14N2O4 — CID 12521150
2,2-dibenzamidoacetic acid (PubChem CID 12521150) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2,2-dibenzamidoacetic acid.
| Compound Name | 2,2-dibenzamidoacetic acid |
|---|---|
| PubChem CID | 12521150 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2,2-dibenzamidoacetic acid |
| SMILES | O=C(NC(NC(=O)c1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O4/c19-14(11-7-3-1-4-8-11)17-13(16(21)22)18-15(20)12-9-5-2-6-10-12/h1-10,13H,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | UPZHESZQHMDXRC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|