C9H7Cl3NO4S- — CID 2252685
(1S)-1-benzamido-2,2,2-trichloroethanesulfonate (PubChem CID 2252685) has the molecular formula C9H7Cl3NO4S- and a molecular weight of 331.58 g/mol. Its IUPAC name is (1S)-1-benzamido-2,2,2-trichloroethanesulfonate.
| Compound Name | (1S)-1-benzamido-2,2,2-trichloroethanesulfonate |
|---|---|
| PubChem CID | 2252685 |
| Molecular Formula | C9H7Cl3NO4S- |
| Molecular Weight | 331.58 g/mol |
| Exact Mass | 329.92 |
| IUPAC Name | (1S)-1-benzamido-2,2,2-trichloroethanesulfonate |
| SMILES | O=C(N[C@H](C(Cl)(Cl)Cl)S(=O)(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C9H8Cl3NO4S/c10-9(11,12)8(18(15,16)17)13-7(14)6-4-2-1-3-5-6/h1-5,8H,(H,13,14)(H,15,16,17)/p-1/t8-/m0/s1 |
| InChIKey | ZJUHEQWJJRGZFD-QMMMGPOBSA-M |
| XLogP | 1.66 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.58 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|