C10H12Cl2N2O — CID 10868605
N-[2,2-dichloro-1-(methylamino)ethyl]benzamide (PubChem CID 10868605) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.13 g/mol. Its IUPAC name is N-[2,2-dichloro-1-(methylamino)ethyl]benzamide.
| Compound Name | N-[2,2-dichloro-1-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 10868605 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | N-[2,2-dichloro-1-(methylamino)ethyl]benzamide |
| SMILES | CNC(NC(=O)c1ccccc1)C(Cl)Cl |
| InChI | InChI=1S/C10H12Cl2N2O/c1-13-9(8(11)12)14-10(15)7-5-3-2-4-6-7/h2-6,8-9,13H,1H3,(H,14,15) |
| InChIKey | KXWSZNFPPBVFHH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|