C11H14N2O2 — CID 68732786
N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]benzamide (PubChem CID 68732786) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 68732786 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]benzamide |
| SMILES | CNC(=O)[C@H](C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O2/c1-8(10(14)12-2)13-11(15)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,12,14)(H,13,15)/t8-/m0/s1 |
| InChIKey | XDGWGZNTONSHIB-QMMMGPOBSA-N |
| XLogP | 0.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |