C22H26N4O4 — CID 71491153
N-[(2S)-1-[2-[[(2S)-2-benzamidopropanoyl]amino]ethylamino]-1-oxopropan-2-yl]benzamide (PubChem CID 71491153) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[(2S)-1-[2-[[(2S)-2-benzamidopropanoyl]amino]ethylamino]-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[2-[[(2S)-2-benzamidopropanoyl]amino]ethylamino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 71491153 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[(2S)-1-[2-[[(2S)-2-benzamidopropanoyl]amino]ethylamino]-1-oxopropan-2-yl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1)C(=O)NCCNC(=O)[C@H](C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N4O4/c1-15(25-21(29)17-9-5-3-6-10-17)19(27)23-13-14-24-20(28)16(2)26-22(30)18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3,(H,23,27)(H,24,28)(H,25,29)(H,26,30)/t15-,16-/m0/s1 |
| InChIKey | SRMXOGNNGKLKFA-HOTGVXAUSA-N |
| XLogP | 0.86 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|