C46H44N4O4P2 — CID 122367982
3-diphenylphosphanyl-N-[(2S)-1-[2-[[(2S)-2-[(3-diphenylphosphanylbenzoyl)amino]propanoyl]amino]ethylamino]-1-oxopropan-2-yl]benzamide (PubChem CID 122367982) has the molecular formula C46H44N4O4P2 and a molecular weight of 778.83 g/mol. Its IUPAC name is 3-diphenylphosphanyl-N-[(2S)-1-[2-[[(2S)-2-[(3-diphenylphosphanylbenzoyl)amino]propanoyl]amino]ethylamino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 3-diphenylphosphanyl-N-[(2S)-1-[2-[[(2S)-2-[(3-diphenylphosphanylbenzoyl)amino]propanoyl]amino]ethylamino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 122367982 |
| Molecular Formula | C46H44N4O4P2 |
| Molecular Weight | 778.83 g/mol |
| Exact Mass | 778.28 |
| IUPAC Name | 3-diphenylphosphanyl-N-[(2S)-1-[2-[[(2S)-2-[(3-diphenylphosphanylbenzoyl)amino]propanoyl]amino]ethylamino]-1-oxopropan-2-yl]benzamide |
| SMILES | C[C@H](NC(=O)c1cccc(P(c2ccccc2)c2ccccc2)c1)C(=O)NCCNC(=O)[C@H](C)NC(=O)c1cccc(P(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C46H44N4O4P2/c1-33(49-45(53)35-17-15-27-41(31-35)55(37-19-7-3-8-20-37)38-21-9-4-10-22-38)43(51)47-29-30-48-44(52)34(2)50-46(54)36-18-16-28-42(32-36)56(39-23-11-5-12-24-39)40-25-13-6-14-26-40/h3-28,31-34H,29-30H2,1-2H3,(H,47,51)(H,48,52)(H,49,53)(H,50,54)/t33-,34-/m0/s1 |
| InChIKey | CSGRPVZNNHOWCA-HEVIKAOCSA-N |
| XLogP | 4.37 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|