C48H48N4O4P2 — CID 122367986
3-diphenylphosphanyl-N-[(2S)-1-[4-[[(2S)-2-[(3-diphenylphosphanylbenzoyl)amino]propanoyl]amino]butylamino]-1-oxopropan-2-yl]benzamide (PubChem CID 122367986) has the molecular formula C48H48N4O4P2 and a molecular weight of 806.88 g/mol. Its IUPAC name is 3-diphenylphosphanyl-N-[(2S)-1-[4-[[(2S)-2-[(3-diphenylphosphanylbenzoyl)amino]propanoyl]amino]butylamino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 3-diphenylphosphanyl-N-[(2S)-1-[4-[[(2S)-2-[(3-diphenylphosphanylbenzoyl)amino]propanoyl]amino]butylamino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 122367986 |
| Molecular Formula | C48H48N4O4P2 |
| Molecular Weight | 806.88 g/mol |
| Exact Mass | 806.32 |
| IUPAC Name | 3-diphenylphosphanyl-N-[(2S)-1-[4-[[(2S)-2-[(3-diphenylphosphanylbenzoyl)amino]propanoyl]amino]butylamino]-1-oxopropan-2-yl]benzamide |
| SMILES | C[C@H](NC(=O)c1cccc(P(c2ccccc2)c2ccccc2)c1)C(=O)NCCCCNC(=O)[C@H](C)NC(=O)c1cccc(P(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C48H48N4O4P2/c1-35(51-47(55)37-19-17-29-43(33-37)57(39-21-7-3-8-22-39)40-23-9-4-10-24-40)45(53)49-31-15-16-32-50-46(54)36(2)52-48(56)38-20-18-30-44(34-38)58(41-25-11-5-12-26-41)42-27-13-6-14-28-42/h3-14,17-30,33-36H,15-16,31-32H2,1-2H3,(H,49,53)(H,50,54)(H,51,55)(H,52,56)/t35-,36-/m0/s1 |
| InChIKey | WGOMMTXYRBYADO-ZPGRZCPFSA-N |
| XLogP | 5.15 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.88 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|