C15H20N2O2 — CID 115628431
N-[1-oxo-1-[[(E)-pent-3-enyl]amino]propan-2-yl]benzamide (PubChem CID 115628431) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-[1-oxo-1-[[(E)-pent-3-enyl]amino]propan-2-yl]benzamide.
| Compound Name | N-[1-oxo-1-[[(E)-pent-3-enyl]amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 115628431 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-[1-oxo-1-[[(E)-pent-3-enyl]amino]propan-2-yl]benzamide |
| SMILES | C/C=C/CCNC(=O)C(C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c1-3-4-8-11-16-14(18)12(2)17-15(19)13-9-6-5-7-10-13/h3-7,9-10,12H,8,11H2,1-2H3,(H,16,18)(H,17,19)/b4-3+ |
| InChIKey | XIOPYBFMLZJIHF-ONEGZZNKSA-N |
| XLogP | 1.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|