C16H24N2O3 — CID 103861524
N-[1-[(5-hydroxy-4-methylpentyl)amino]-1-oxopropan-2-yl]benzamide (PubChem CID 103861524) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[1-[(5-hydroxy-4-methylpentyl)amino]-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[1-[(5-hydroxy-4-methylpentyl)amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 103861524 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-[1-[(5-hydroxy-4-methylpentyl)amino]-1-oxopropan-2-yl]benzamide |
| SMILES | CC(CO)CCCNC(=O)C(C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O3/c1-12(11-19)7-6-10-17-15(20)13(2)18-16(21)14-8-4-3-5-9-14/h3-5,8-9,12-13,19H,6-7,10-11H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | LSDBXEVXUZSYSZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|