C14H16N2O6 — CID 40571628
(2S)-2-[[3-[[(1S)-1-carboxyethyl]carbamoyl]benzoyl]amino]propanoic acid (PubChem CID 40571628) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is (2S)-2-[[3-[[(1S)-1-carboxyethyl]carbamoyl]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[3-[[(1S)-1-carboxyethyl]carbamoyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 40571628 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2S)-2-[[3-[[(1S)-1-carboxyethyl]carbamoyl]benzoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)c1cccc(C(=O)N[C@@H](C)C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C14H16N2O6/c1-7(13(19)20)15-11(17)9-4-3-5-10(6-9)12(18)16-8(2)14(21)22/h3-8H,1-2H3,(H,15,17)(H,16,18)(H,19,20)(H,21,22)/t7-,8-/m0/s1 |
| InChIKey | LHKRKQPIFWIFHX-YUMQZZPRSA-N |
| XLogP | 0.09 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |