C20H20N4O6 — CID 102421825
(2S)-2-[[3-[[3-[[(1S)-1-carboxyethyl]carbamoyl]phenyl]diazenyl]benzoyl]amino]propanoic acid (PubChem CID 102421825) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is (2S)-2-[[3-[[3-[[(1S)-1-carboxyethyl]carbamoyl]phenyl]diazenyl]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[3-[[3-[[(1S)-1-carboxyethyl]carbamoyl]phenyl]diazenyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 102421825 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (2S)-2-[[3-[[3-[[(1S)-1-carboxyethyl]carbamoyl]phenyl]diazenyl]benzoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)c1cccc(/N=N/c2cccc(C(=O)N[C@@H](C)C(=O)O)c2)c1)C(=O)O |
| InChI | InChI=1S/C20H20N4O6/c1-11(19(27)28)21-17(25)13-5-3-7-15(9-13)23-24-16-8-4-6-14(10-16)18(26)22-12(2)20(29)30/h3-12H,1-2H3,(H,21,25)(H,22,26)(H,27,28)(H,29,30)/b24-23+/t11-,12-/m0/s1 |
| InChIKey | VAMFENDRRCDDPV-CXRDDUQQSA-N |
| XLogP | 2.51 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|