(2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid

C10H11NO4 — CID 20848017

IUPAC(2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid
SMILESC[C@@H](NC(=O)c1cccc(O)c1)C(=O)O
InChIInChI=1S/C10H11NO4/c1-6(10(14)15)11-9(13)7-3-2-4-8(12)5-7/h2-6,12H,1H3,(H,11,13)(H,14,15)/t6-/m1/s1
InChIKeyIJNXADVFECOWAE-ZCFIWIBFSA-N
MW209.20 g/mol
LogP0.60
Rot. Bonds3

About (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid

(2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid (PubChem CID 20848017) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid.

Molecular Properties

Compound Name(2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid
PubChem CID20848017
Molecular FormulaC10H11NO4
Molecular Weight209.20 g/mol
Exact Mass209.07
IUPAC Name(2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid
SMILESC[C@@H](NC(=O)c1cccc(O)c1)C(=O)O
InChIInChI=1S/C10H11NO4/c1-6(10(14)15)11-9(13)7-3-2-4-8(12)5-7/h2-6,12H,1H3,(H,11,13)(H,14,15)/t6-/m1/s1
InChIKeyIJNXADVFECOWAE-ZCFIWIBFSA-N
XLogP0.60
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.20
LogP ≤ 50.60
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-2-[[3-[[(1S)-1-carboxyethyl]carbamoyl]benzoyl]amino]propanoic acid
CID 40571628
N-[(2R)-1-amino-1-oxopropan-2-yl]-3-hydroxybenzamide
CID 171390389
(2S)-2-[[3-[[3-[[(1S)-1-carboxyethyl]carbamoyl]phenyl]diazenyl]benzoyl]amino]propanoic acid
CID 102421825
(2S)-2-[(3-methoxybenzoyl)amino]propanoic acid
CID 42254442
2-[[3-(methoxymethyl)benzoyl]amino]propanoic acid
CID 43170851
2-[[4-(1-carboxyethylcarbamoyl)benzoyl]amino]propanoic acid
CID 4130949
(2R)-2-[[4-[[(1R)-1-carboxyethyl]carbamoyl]benzoyl]amino]propanoic acid
CID 40571784
(2R)-2-[(3-pyrrol-1-ylbenzoyl)amino]propanoic acid
CID 54991443
2-[(3-hydroxy-4-methylbenzoyl)amino]propanoic acid
CID 16778253
(2S)-2-[[3-(trifluoromethoxy)benzoyl]amino]propanoic acid
CID 120525960
(2R)-2-[[3-(trifluoromethoxy)benzoyl]amino]propanoic acid
CID 120526943
3-hydroxy-N-[1-(2-methylphenyl)ethyl]benzamide
CID 60638374

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid?
The IUPAC name of (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid (CID 20848017) is (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid.
What is the SMILES notation for (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid?
The canonical SMILES for (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid is C[C@@H](NC(=O)c1cccc(O)c1)C(=O)O.
What is the InChIKey of (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid?
The InChIKey is IJNXADVFECOWAE-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H11NO4/c1-6(10(14)15)11-9(13)7-3-2-4-8(12)5-7/h2-6,12H,1H3,(H,11,13)(H,14,15)/t6-/m1/s1.
What are the key properties of (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid?
(2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid has a molecular weight of 209.20 g/mol, XLogP of 0.60, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3-hydroxybenzoyl)amino]propanoic acid is sourced from PubChem (CID 20848017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).