C10H8Cl2N2OS — CID 14667703
N-(2,2-dichloro-1-isothiocyanatoethyl)benzamide (PubChem CID 14667703) has the molecular formula C10H8Cl2N2OS and a molecular weight of 275.16 g/mol. Its IUPAC name is N-(2,2-dichloro-1-isothiocyanatoethyl)benzamide.
| Compound Name | N-(2,2-dichloro-1-isothiocyanatoethyl)benzamide |
|---|---|
| PubChem CID | 14667703 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | N-(2,2-dichloro-1-isothiocyanatoethyl)benzamide |
| SMILES | O=C(NC(N=C=S)C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C10H8Cl2N2OS/c11-8(12)9(13-6-16)14-10(15)7-4-2-1-3-5-7/h1-5,8-9H,(H,14,15) |
| InChIKey | KFKJAUXBFQCWTG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|