C10H6Cl3IN2OS — CID 18770714
4-iodo-N-(2,2,2-trichloro-1-isothiocyanatoethyl)benzamide (PubChem CID 18770714) has the molecular formula C10H6Cl3IN2OS and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-iodo-N-(2,2,2-trichloro-1-isothiocyanatoethyl)benzamide.
| Compound Name | 4-iodo-N-(2,2,2-trichloro-1-isothiocyanatoethyl)benzamide |
|---|---|
| PubChem CID | 18770714 |
| Molecular Formula | C10H6Cl3IN2OS |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 433.83 |
| IUPAC Name | 4-iodo-N-(2,2,2-trichloro-1-isothiocyanatoethyl)benzamide |
| SMILES | O=C(NC(N=C=S)C(Cl)(Cl)Cl)c1ccc(I)cc1 |
| InChI | InChI=1S/C10H6Cl3IN2OS/c11-10(12,13)9(15-5-18)16-8(17)6-1-3-7(14)4-2-6/h1-4,9H,(H,16,17) |
| InChIKey | BIQDVRBSNGRDAR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|