C16H13Cl3N4O — CID 11292036
4-methyl-N-[2,2,2-trichloro-1-(pyridin-3-yliminomethylideneamino)ethyl]benzamide (PubChem CID 11292036) has the molecular formula C16H13Cl3N4O and a molecular weight of 383.67 g/mol. Its IUPAC name is 4-methyl-N-[2,2,2-trichloro-1-(pyridin-3-yliminomethylideneamino)ethyl]benzamide.
| Compound Name | 4-methyl-N-[2,2,2-trichloro-1-(pyridin-3-yliminomethylideneamino)ethyl]benzamide |
|---|---|
| PubChem CID | 11292036 |
| Molecular Formula | C16H13Cl3N4O |
| Molecular Weight | 383.67 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 4-methyl-N-[2,2,2-trichloro-1-(pyridin-3-yliminomethylideneamino)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(N=C=Nc2cccnc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H13Cl3N4O/c1-11-4-6-12(7-5-11)14(24)23-15(16(17,18)19)22-10-21-13-3-2-8-20-9-13/h2-9,15H,1H3,(H,23,24) |
| InChIKey | RSRSMWTUIHIWQC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|