C16H13Cl3N6O — CID 22953517
N-[2,2,2-trichloro-1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]ethyl]benzamide (PubChem CID 22953517) has the molecular formula C16H13Cl3N6O and a molecular weight of 411.68 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]ethyl]benzamide.
| Compound Name | N-[2,2,2-trichloro-1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 22953517 |
| Molecular Formula | C16H13Cl3N6O |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]ethyl]benzamide |
| SMILES | N#CN/C(=N/C(NC(=O)c1ccccc1)C(Cl)(Cl)Cl)Nc1cccnc1 |
| InChI | InChI=1S/C16H13Cl3N6O/c17-16(18,19)14(24-13(26)11-5-2-1-3-6-11)25-15(22-10-20)23-12-7-4-8-21-9-12/h1-9,14H,(H,24,26)(H2,22,23,25) |
| InChIKey | USNLQXVJCGGNOX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|