C22H28ClN7O — CID 18770767
4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-4-(dimethylamino)-2,2-dimethylbutyl]benzamide (PubChem CID 18770767) has the molecular formula C22H28ClN7O and a molecular weight of 441.97 g/mol. Its IUPAC name is 4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-4-(dimethylamino)-2,2-dimethylbutyl]benzamide.
| Compound Name | 4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-4-(dimethylamino)-2,2-dimethylbutyl]benzamide |
|---|---|
| PubChem CID | 18770767 |
| Molecular Formula | C22H28ClN7O |
| Molecular Weight | 441.97 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-4-(dimethylamino)-2,2-dimethylbutyl]benzamide |
| SMILES | CN(C)CCC(C)(C)C(/N=C(/NC#N)Nc1cccnc1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H28ClN7O/c1-22(2,11-13-30(3)4)20(28-19(31)16-7-9-17(23)10-8-16)29-21(26-15-24)27-18-6-5-12-25-14-18/h5-10,12,14,20H,11,13H2,1-4H3,(H,28,31)(H2,26,27,29) |
| InChIKey | VKROSJVEUORTKO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.97 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|