C18H22ClN5O2 — CID 87797173
4-chloro-N-[1-[(Z)-[(hydroxyamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpropyl]benzamide (PubChem CID 87797173) has the molecular formula C18H22ClN5O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 4-chloro-N-[1-[(Z)-[(hydroxyamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpropyl]benzamide.
| Compound Name | 4-chloro-N-[1-[(Z)-[(hydroxyamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpropyl]benzamide |
|---|---|
| PubChem CID | 87797173 |
| Molecular Formula | C18H22ClN5O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-chloro-N-[1-[(Z)-[(hydroxyamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethylpropyl]benzamide |
| SMILES | CC(C)(C)C(/N=C(\NO)Nc1cccnc1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClN5O2/c1-18(2,3)16(22-15(25)12-6-8-13(19)9-7-12)23-17(24-26)21-14-5-4-10-20-11-14/h4-11,16,26H,1-3H3,(H,22,25)(H2,21,23,24) |
| InChIKey | MXTXDDDWXYCAPK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|