C24H25ClN6O3 — CID 10184350
4-chloro-N-[2,2-dimethyl-1-[(Z)-[nitramido-(pyridin-3-ylamino)methylidene]amino]-3-phenylpropyl]benzamide (PubChem CID 10184350) has the molecular formula C24H25ClN6O3 and a molecular weight of 480.96 g/mol. Its IUPAC name is 4-chloro-N-[2,2-dimethyl-1-[(Z)-[nitramido-(pyridin-3-ylamino)methylidene]amino]-3-phenylpropyl]benzamide.
| Compound Name | 4-chloro-N-[2,2-dimethyl-1-[(Z)-[nitramido-(pyridin-3-ylamino)methylidene]amino]-3-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 10184350 |
| Molecular Formula | C24H25ClN6O3 |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 4-chloro-N-[2,2-dimethyl-1-[(Z)-[nitramido-(pyridin-3-ylamino)methylidene]amino]-3-phenylpropyl]benzamide |
| SMILES | CC(C)(Cc1ccccc1)C(/N=C(/Nc1cccnc1)N[N+](=O)[O-])NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H25ClN6O3/c1-24(2,15-17-7-4-3-5-8-17)22(28-21(32)18-10-12-19(25)13-11-18)29-23(30-31(33)34)27-20-9-6-14-26-16-20/h3-14,16,22H,15H2,1-2H3,(H,28,32)(H2,27,29,30) |
| InChIKey | LEJATAVHADOAMR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|