C18H19Cl3N6O3 — CID 90970045
4-chloro-N-[2,2-dichloro-1-[[nitramido-(pyridin-3-ylamino)methylidene]amino]pentyl]benzamide (PubChem CID 90970045) has the molecular formula C18H19Cl3N6O3 and a molecular weight of 473.75 g/mol. Its IUPAC name is 4-chloro-N-[2,2-dichloro-1-[[nitramido-(pyridin-3-ylamino)methylidene]amino]pentyl]benzamide.
| Compound Name | 4-chloro-N-[2,2-dichloro-1-[[nitramido-(pyridin-3-ylamino)methylidene]amino]pentyl]benzamide |
|---|---|
| PubChem CID | 90970045 |
| Molecular Formula | C18H19Cl3N6O3 |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 4-chloro-N-[2,2-dichloro-1-[[nitramido-(pyridin-3-ylamino)methylidene]amino]pentyl]benzamide |
| SMILES | CCCC(Cl)(Cl)C(N=C(Nc1cccnc1)N[N+](=O)[O-])NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19Cl3N6O3/c1-2-9-18(20,21)16(24-15(28)12-5-7-13(19)8-6-12)25-17(26-27(29)30)23-14-4-3-10-22-11-14/h3-8,10-11,16H,2,9H2,1H3,(H,24,28)(H2,23,25,26) |
| InChIKey | RYGAQMKLTGPEKA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|