C21H23ClN6O3 — CID 18770521
4-chloro-N-[[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-(5-ethyl-1,3-dioxan-5-yl)methyl]benzamide (PubChem CID 18770521) has the molecular formula C21H23ClN6O3 and a molecular weight of 442.91 g/mol. Its IUPAC name is 4-chloro-N-[[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-(5-ethyl-1,3-dioxan-5-yl)methyl]benzamide.
| Compound Name | 4-chloro-N-[[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-(5-ethyl-1,3-dioxan-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 18770521 |
| Molecular Formula | C21H23ClN6O3 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 4-chloro-N-[[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-(5-ethyl-1,3-dioxan-5-yl)methyl]benzamide |
| SMILES | CCC1(C(/N=C(/NC#N)Nc2cccnc2)NC(=O)c2ccc(Cl)cc2)COCOC1 |
| InChI | InChI=1S/C21H23ClN6O3/c1-2-21(11-30-14-31-12-21)19(27-18(29)15-5-7-16(22)8-6-15)28-20(25-13-23)26-17-4-3-9-24-10-17/h3-10,19H,2,11-12,14H2,1H3,(H,27,29)(H2,25,26,28) |
| InChIKey | SIEZDXSNJNQWQR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|