C20H24ClN7O3S — CID 18770649
4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethyl-4-sulfamoylbutyl]benzamide (PubChem CID 18770649) has the molecular formula C20H24ClN7O3S and a molecular weight of 477.98 g/mol. Its IUPAC name is 4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethyl-4-sulfamoylbutyl]benzamide.
| Compound Name | 4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethyl-4-sulfamoylbutyl]benzamide |
|---|---|
| PubChem CID | 18770649 |
| Molecular Formula | C20H24ClN7O3S |
| Molecular Weight | 477.98 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 4-chloro-N-[1-[(E)-[(cyanoamino)-(pyridin-3-ylamino)methylidene]amino]-2,2-dimethyl-4-sulfamoylbutyl]benzamide |
| SMILES | CC(C)(CCS(N)(=O)=O)C(/N=C(/NC#N)Nc1cccnc1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClN7O3S/c1-20(2,9-11-32(23,30)31)18(27-17(29)14-5-7-15(21)8-6-14)28-19(25-13-22)26-16-4-3-10-24-12-16/h3-8,10,12,18H,9,11H2,1-2H3,(H,27,29)(H2,23,30,31)(H2,25,26,28) |
| InChIKey | QKQHYQRTAIIYFF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 162.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.98 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|